CAS 56484-13-0 appears in our catalog under these names: ZINCON SODIUM SALT, DYE CONTENT >=75%, Zincon sodium salt, Dye content≥75 %, Dye content≥75 %. Offered by: Sigma-Aldrich, Chemat. Available pack sizes: 1G, 5G.
Sodium 3-[(2E)-2-[[(2-carboxyphenyl)diazenyl]-phenylmethylidene]hydrazinyl]-4-hydroxybenzenesulfonate (CAS 56484-13-0) is a chemical compound with the molecular formula C20H15N4NaO6S and a molecular weight of 462.4 g/mol. IUPAC name: sodium 3-[(2E)-2-[[(2-carboxyphenyl)diazenyl]-phenylmethylidene]hydrazinyl]-4-hydroxybenzenesulfonate. InChIKey: XBGLXASXFRESIN-JGXOCYJHSA-M.
| Molecular formula | C20H15N4NaO6S |
|---|---|
| Molecular weight | 462.4 g/mol |
| IUPAC name | sodium 3-[(2E)-2-[[(2-carboxyphenyl)diazenyl]-phenylmethylidene]hydrazinyl]-4-hydroxybenzenesulfonate |
| InChIKey | XBGLXASXFRESIN-JGXOCYJHSA-M |
| SMILES | C1=CC=C(C=C1)/C(=N\NC2=C(C=CC(=C2)S(=O)(=O)[O-])O)/N=NC3=CC=CC=C3C(=O)O.[Na+] |
Computed by PubChem (NCBI)