Products 5649-36-5

CAS 5649-36-5 appears in our catalog under these names: 2,6-Dimethyl-1h-indole, 97%, 2,6–Dimethyl–1H–indole, 2,6-Dimethyl-1H-indole 97%, 2,6-Dimethyl-1H-Indole, 97%, 97%, 2,6-Dimethyl-1H-indole, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.

Structural formula: {0} (CAS {1})

2,6-dimethyl-1H-indole (CAS 5649-36-5) is a chemical compound with the molecular formula C10H11N and a molecular weight of 145.20 g/mol. IUPAC name: 2,6-dimethyl-1H-indole. InChIKey: IVEOPBYBMLADDC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11N
Molecular weight145.20 g/mol
IUPAC name2,6-dimethyl-1H-indole
InChIKeyIVEOPBYBMLADDC-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1)C=C(N2)C

Computed by PubChem (NCBI)