Products 56496-16-3
CAS 56496-16-3 appears in our catalog under these names: 6-Azaspiro[5.5]undecan-6-ium chloride, 95%, 6-Azaspiro[5.5]undecan-6-ium chloride, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
6-azoniaspiro[5.5]undecane chloride (CAS 56496-16-3) is a chemical compound with the molecular formula C10H20ClN and a molecular weight of 189.72 g/mol. IUPAC name: 6-azoniaspiro[5.5]undecane chloride. InChIKey: ANJFPNVWAISDQR-UHFFFAOYSA-M.
| Molecular formula | C10H20ClN |
|---|---|
| Molecular weight | 189.72 g/mol |
| IUPAC name | 6-azoniaspiro[5.5]undecane chloride |
| InChIKey | ANJFPNVWAISDQR-UHFFFAOYSA-M |
| SMILES | C1CC[N+]2(CC1)CCCCC2.[Cl-] |
Computed by PubChem (NCBI)