CAS 565-40-2 is the registry number for N-Cyclohexyl 4-fluorobenzenesulfonamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 5g, 1g.
N-cyclohexyl-4-fluorobenzenesulfonamide (CAS 565-40-2) is a chemical compound with the molecular formula C12H16FNO2S and a molecular weight of 257.33 g/mol. IUPAC name: N-cyclohexyl-4-fluorobenzenesulfonamide. InChIKey: YUSOTJWNKVVYIR-UHFFFAOYSA-N.
| Molecular formula | C12H16FNO2S |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | N-cyclohexyl-4-fluorobenzenesulfonamide |
| InChIKey | YUSOTJWNKVVYIR-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NS(=O)(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)