CAS 56512-49-3 appears in our catalog under these names: Dabsyl chloride, 98%, Dabsyl Chloride, Dabsyl chloride/ min. 98%, Dabsyl chloride (DABS–Cl), 4-Dimethylaminoazobenzene-4'-sulfonyl chloride, 98+% . Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 25g, 1g, 5g, 250mg, 100mg, 50mg, 500mg, 100 mg.
4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonyl chloride (CAS 56512-49-3) is a chemical compound with the molecular formula C14H14ClN3O2S and a molecular weight of 323.8 g/mol. IUPAC name: 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonyl chloride. InChIKey: VTVWTPGLLAELLI-UHFFFAOYSA-N.
| Molecular formula | C14H14ClN3O2S |
|---|---|
| Molecular weight | 323.8 g/mol |
| IUPAC name | 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonyl chloride |
| InChIKey | VTVWTPGLLAELLI-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)