CAS 56516-72-4 appears in our catalog under these names: N-Nitroso-Glyphosate, Glyphosate Impurity 1 (N-Nitroso-Glyphosate), N-Nitroso-N-(phosphonomethyl)glycine, >95% (HPLC), N-Nitrosoglyphosate, Nitrosoglyphosate. Offered by: Chemat Brand, Hubei YoungXin, TRC, MedChemExpress, HPC Standards. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 10 mg, 5 mg.
2-[nitroso(phosphonomethyl)amino]acetic acid (CAS 56516-72-4) is a chemical compound with the molecular formula C3H7N2O6P and a molecular weight of 198.07 g/mol. IUPAC name: 2-[nitroso(phosphonomethyl)amino]acetic acid. InChIKey: BJYYBQPCMQGLLZ-UHFFFAOYSA-N.
| Molecular formula | C3H7N2O6P |
|---|---|
| Molecular weight | 198.07 g/mol |
| IUPAC name | 2-[nitroso(phosphonomethyl)amino]acetic acid |
| InChIKey | BJYYBQPCMQGLLZ-UHFFFAOYSA-N |
| SMILES | C(C(=O)O)N(CP(=O)(O)O)N=O |
Computed by PubChem (NCBI)