CAS 565165-62-0 is the registry number for 2-({5-((2,6-dimethylphenyl)amino)-1,3,4-thiadiazol-2-yl}sulfanyl)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[[5-(2,6-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid (CAS 565165-62-0) is a chemical compound with the molecular formula C12H13N3O2S2 and a molecular weight of 295.4 g/mol. IUPAC name: 2-[[5-(2,6-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid. InChIKey: FAGXJGCSEOVNKV-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O2S2 |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | 2-[[5-(2,6-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid |
| InChIKey | FAGXJGCSEOVNKV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC2=NN=C(S2)SCC(=O)O |
Computed by PubChem (NCBI)