CAS 565166-89-4 appears in our catalog under these names: 2-(3-Chloro-4-fluorophenyl)-2,3-dihydro-1,2-benzothiazol-3-one, 95%, 2-(3-Chloro-4-fluorophenyl)-2,3-dihydro-1,2-benzothiazol-3-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(3-chloro-4-fluorophenyl)-1,2-benzothiazol-3-one (CAS 565166-89-4) is a chemical compound with the molecular formula C13H7ClFNOS and a molecular weight of 279.72 g/mol. IUPAC name: 2-(3-chloro-4-fluorophenyl)-1,2-benzothiazol-3-one. InChIKey: KNZIUIOSXDGDAP-UHFFFAOYSA-N.
| Molecular formula | C13H7ClFNOS |
|---|---|
| Molecular weight | 279.72 g/mol |
| IUPAC name | 2-(3-chloro-4-fluorophenyl)-1,2-benzothiazol-3-one |
| InChIKey | KNZIUIOSXDGDAP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(S2)C3=CC(=C(C=C3)F)Cl |
Computed by PubChem (NCBI)