CAS 565169-58-6 appears in our catalog under these names: 2-(4-Bromo-phenyl)-imidazo[2,1-a]phthalazin-6-ylamine, 95%, 2-(4-Bromophenyl)imidazo(2,1-a)phthalazin-6-amine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-(4-bromophenyl)imidazo[2,1-a]phthalazin-6-amine (CAS 565169-58-6) is a chemical compound with the molecular formula C16H11BrN4 and a molecular weight of 339.19 g/mol. IUPAC name: 2-(4-bromophenyl)imidazo[2,1-a]phthalazin-6-amine. InChIKey: ILCFXOKVYROPRQ-UHFFFAOYSA-N.
| Molecular formula | C16H11BrN4 |
|---|---|
| Molecular weight | 339.19 g/mol |
| IUPAC name | 2-(4-bromophenyl)imidazo[2,1-a]phthalazin-6-amine |
| InChIKey | ILCFXOKVYROPRQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN3C2=NC(=C3)C4=CC=C(C=C4)Br)N |
Computed by PubChem (NCBI)