Products 565172-42-1
CAS 565172-42-1 is the registry number for 2-Fluoro-n-(4-hydroxy-phenyl)-n-methyl-benzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-fluoro-N-(4-hydroxyphenyl)-N-methylbenzenesulfonamide (CAS 565172-42-1) is a chemical compound with the molecular formula C13H12FNO3S and a molecular weight of 281.30 g/mol. IUPAC name: 2-fluoro-N-(4-hydroxyphenyl)-N-methylbenzenesulfonamide. InChIKey: AZGSGUOTLVNEGI-UHFFFAOYSA-N.
| Molecular formula | C13H12FNO3S |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | 2-fluoro-N-(4-hydroxyphenyl)-N-methylbenzenesulfonamide |
| InChIKey | AZGSGUOTLVNEGI-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=C(C=C1)O)S(=O)(=O)C2=CC=CC=C2F |
Computed by PubChem (NCBI)