CAS 565194-87-8 is the registry number for 5-(3-(Morpholine-4-sulfonyl)phenyl)-1,3,4-oxadiazole-2-thiol. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
5-(3-morpholin-4-ylsulfonylphenyl)-3H-1,3,4-oxadiazole-2-thione (CAS 565194-87-8) is a chemical compound with the molecular formula C12H13N3O4S2 and a molecular weight of 327.4 g/mol. IUPAC name: 5-(3-morpholin-4-ylsulfonylphenyl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: RNPILHVKCRFDKZ-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O4S2 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 5-(3-morpholin-4-ylsulfonylphenyl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | RNPILHVKCRFDKZ-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)C2=CC=CC(=C2)C3=NNC(=S)O3 |
Computed by PubChem (NCBI)