CAS 565195-75-7 appears in our catalog under these names: 3-[(3-Chloro-benzenesulfonyl)-(4-methoxy-phenyl)-amino]-propionic acid, 95%, 3-(N-(4-Methoxyphenyl)3-chlorobenzenesulfonamido)propanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
3-(N-(3-chlorophenyl)sulfonyl-4-methoxyanilino)propanoic acid (CAS 565195-75-7) is a chemical compound with the molecular formula C16H16ClNO5S and a molecular weight of 369.8 g/mol. IUPAC name: 3-(N-(3-chlorophenyl)sulfonyl-4-methoxyanilino)propanoic acid. InChIKey: LGJFDSGDQCZRPF-UHFFFAOYSA-N.
| Molecular formula | C16H16ClNO5S |
|---|---|
| Molecular weight | 369.8 g/mol |
| IUPAC name | 3-(N-(3-chlorophenyl)sulfonyl-4-methoxyanilino)propanoic acid |
| InChIKey | LGJFDSGDQCZRPF-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N(CCC(=O)O)S(=O)(=O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)