Products 565198-70-1

CAS 565198-70-1 is the registry number for 5-[Benzyl-(4-methoxy-phenyl)-sulfamoyl]-2-chloro-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

5-[benzyl-(4-methoxyphenyl)sulfamoyl]-2-chlorobenzoic acid (CAS 565198-70-1) is a chemical compound with the molecular formula C21H18ClNO5S and a molecular weight of 431.9 g/mol. IUPAC name: 5-[benzyl-(4-methoxyphenyl)sulfamoyl]-2-chlorobenzoic acid. InChIKey: MIDOOKBEQZGTSZ-UHFFFAOYSA-N.

Identity
Molecular formulaC21H18ClNO5S
Molecular weight431.9 g/mol
IUPAC name5-[benzyl-(4-methoxyphenyl)sulfamoyl]-2-chlorobenzoic acid
InChIKeyMIDOOKBEQZGTSZ-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)N(CC2=CC=CC=C2)S(=O)(=O)C3=CC(=C(C=C3)Cl)C(=O)O

Computed by PubChem (NCBI)