Products 565226-14-4
CAS 565226-14-4 is the registry number for 2,3,4-Tri-O-acetyl-6-azido-6-deoxy-β-D-glucopyranosylamine. Offered by: Chemat. Available pack sizes: 100mg, 10mg, 25mg, 50mg.
[(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-amino-2-(azidomethyl)oxan-3-yl] acetate (CAS 565226-14-4) is a chemical compound with the molecular formula C12H18N4O7 and a molecular weight of 330.29 g/mol. IUPAC name: [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-amino-2-(azidomethyl)oxan-3-yl] acetate. InChIKey: HDIBUTVKFNXVDW-RMPHRYRLSA-N.
| Molecular formula | C12H18N4O7 |
|---|---|
| Molecular weight | 330.29 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-amino-2-(azidomethyl)oxan-3-yl] acetate |
| InChIKey | HDIBUTVKFNXVDW-RMPHRYRLSA-N |
| SMILES | CC(=O)O[C@@H]1[C@H](O[C@H]([C@@H]([C@H]1OC(=O)C)OC(=O)C)N)CN=[N+]=[N-] |
Computed by PubChem (NCBI)