CAS 56523-47-8 appears in our catalog under these names: (R)-2-Phenylpyrrolidine, (R)–2–Phenylpyrrolidine, (R)-2-Phenylpyrrolidine 97%, (R)-2-Phenylpyrrolidine, 97%, 97%, (R)-2-PHENYLPYRROLIDINE, 98%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 50mg, 250mg, 500mg, 1000mg, 5g.
(2R)-2-phenylpyrrolidine (CAS 56523-47-8) is a chemical compound with the molecular formula C10H13N and a molecular weight of 147.22 g/mol. IUPAC name: (2R)-2-phenylpyrrolidine. InChIKey: JUTDHSGANMHVIC-SNVBAGLBSA-N.
| Molecular formula | C10H13N |
|---|---|
| Molecular weight | 147.22 g/mol |
| IUPAC name | (2R)-2-phenylpyrrolidine |
| InChIKey | JUTDHSGANMHVIC-SNVBAGLBSA-N |
| SMILES | C1C[C@@H](NC1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)