CAS 56525-09-8 appears in our catalog under these names: N-Nitrosoatrazine, >95% (HPLC), N-Nitrosoatrazine. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 1g, 25 mg, 100 mg, 50 mg.
N-[4-chloro-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]-N-ethylnitrous amide (CAS 56525-09-8) is a chemical compound with the molecular formula C8H13ClN6O and a molecular weight of 244.68 g/mol. IUPAC name: N-[4-chloro-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]-N-ethylnitrous amide. InChIKey: WQSMQGITEZLGKF-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN6O |
|---|---|
| Molecular weight | 244.68 g/mol |
| IUPAC name | N-[4-chloro-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]-N-ethylnitrous amide |
| InChIKey | WQSMQGITEZLGKF-UHFFFAOYSA-N |
| SMILES | CCN(C1=NC(=NC(=N1)NC(C)C)Cl)N=O |
Computed by PubChem (NCBI)