CAS 56554-52-0 appears in our catalog under these names: Methyl perfluorododecanoate, 96%, Methylperfluorododecanoate, 98%, Methyl Tricosafluorododecanoate, Methyl Tricosafluorododecanoate, >95.0%(GC), Methyl perfluorododecanoate, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Fluorochem. Available pack sizes: 5g, 100g, 25g, 1g.
Methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecanoate (CAS 56554-52-0) is a chemical compound with the molecular formula C13H3F23O2 and a molecular weight of 628.12 g/mol. IUPAC name: methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecanoate. InChIKey: ABNZIVVYHQYSLI-UHFFFAOYSA-N.
| Molecular formula | C13H3F23O2 |
|---|---|
| Molecular weight | 628.12 g/mol |
| IUPAC name | methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecanoate |
| InChIKey | ABNZIVVYHQYSLI-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)