CAS 56583-49-4 appears in our catalog under these names: 2,2'-Pyridylisatogen Tosylate, PIT, 97%, PIT/ 99.01% (existing batch purity), PIT, 3-Oxo-2-(pyridin-2-yl)-3H-indole 1-oxide 4-methylbenzenesulfonate, 99.01% ,, 99.01% ,. Offered by: TRC, AmBeed, TargetMol, GLPBio, Chemat. Available pack sizes: 500mg, 100mg, 5mg, 10mg, 25mg, 50mg, 1mg, 100 mg.
4-methylbenzenesulfonic acid;1-oxido-2-pyridin-2-ylindol-1-ium-3-one (CAS 56583-49-4) is a chemical compound with the molecular formula C20H16N2O5S and a molecular weight of 396.4 g/mol. IUPAC name: 4-methylbenzenesulfonic acid;1-oxido-2-pyridin-2-ylindol-1-ium-3-one. InChIKey: MMPTYEXNPWSTOR-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O5S |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | 4-methylbenzenesulfonic acid;1-oxido-2-pyridin-2-ylindol-1-ium-3-one |
| InChIKey | MMPTYEXNPWSTOR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1=CC=C2C(=C1)C(=O)C(=[N+]2[O-])C3=CC=CC=N3 |
Computed by PubChem (NCBI)