CAS 56598-35-7 is the registry number for (1,1-Dimethylethyl)diphenylphosphine oxide, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
[tert-butyl(phenyl)phosphoryl]benzene (CAS 56598-35-7) is a chemical compound with the molecular formula C16H19OP and a molecular weight of 258.29 g/mol. IUPAC name: [tert-butyl(phenyl)phosphoryl]benzene. InChIKey: CHFOAXGMRFQIOK-UHFFFAOYSA-N.
| Molecular formula | C16H19OP |
|---|---|
| Molecular weight | 258.29 g/mol |
| IUPAC name | [tert-butyl(phenyl)phosphoryl]benzene |
| InChIKey | CHFOAXGMRFQIOK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)P(=O)(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)