Products 56599-85-0
CAS 56599-85-0 appears in our catalog under these names: Palmitic Acid-13C16, Palmitic acid–13C16, Palmitic acid-¹³C16, PALMITIC ACID-13C16, 99 ATOM % 13C, 99%&, Palmitic acid-13C16, ≥98 atom% 13C,≥98%, ≥98 atom% 13C,≥98%. Offered by: TRC, GLPBio, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 100mg, 250mg, 500mg.
(1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16-13C16)hexadecanoic acid (CAS 56599-85-0) is a chemical compound with the molecular formula C16H32O2 and a molecular weight of 272.31 g/mol. IUPAC name: (1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16-13C16)hexadecanoic acid. InChIKey: IPCSVZSSVZVIGE-BZDICNBSSA-N.
| Molecular formula | C16H32O2 |
|---|---|
| Molecular weight | 272.31 g/mol |
| IUPAC name | (1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16-13C16)hexadecanoic acid |
| InChIKey | IPCSVZSSVZVIGE-BZDICNBSSA-N |
| SMILES | [13CH3][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13C](=O)O |
Computed by PubChem (NCBI)
Synonyms:
Palmitic acid-13C16, (1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16-13C16)Hexadecanoic acid, Palmitic Acid-?13C16, Hexadecanoic acid-13C16, Palmitic acid-13C??, Palmitic acid-(1)(3)C16, orb3138686, (~13~C_16_)Hexadecanoic acid, Palmitic acid-13C16, 99 atom % 13C, 99% (CP), Palmitic acid-13C16, S & P tested, 99 atom % 13C