CAS 5660-45-7 appears in our catalog under these names: Alpha-quinquethiophene, 95%, α–Quinquethiophene, alpha-Quinquethiophene, >98.0%(HPLC), 2,2':5',2'':5'',2''':5''',2''''-Quinquethiophene, 98.0%, 98.0%, 2,2':5',2'':5'',2''':5''',2''''-Quinquethiophene, 95%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
2,5-bis(5-thiophen-2-ylthiophen-2-yl)thiophene (CAS 5660-45-7) is a chemical compound with the molecular formula C20H12S5 and a molecular weight of 412.6 g/mol. IUPAC name: 2,5-bis(5-thiophen-2-ylthiophen-2-yl)thiophene. InChIKey: YFBLUJZFRBFQMR-UHFFFAOYSA-N.
| Molecular formula | C20H12S5 |
|---|---|
| Molecular weight | 412.6 g/mol |
| IUPAC name | 2,5-bis(5-thiophen-2-ylthiophen-2-yl)thiophene |
| InChIKey | YFBLUJZFRBFQMR-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC=C(S2)C3=CC=C(S3)C4=CC=C(S4)C5=CC=CS5 |
Computed by PubChem (NCBI)