CAS 56602-33-6 appears in our catalog under these names: Benzotriazol-1-yloxytris(dimethylamino)phosphonium Hexafluorophosphate, >95% (HPLC), BOP reagent, BOP, 1H-Benzotriazol-1-yloxytris(dimethylamino)phosphonium hexafl, BOP Reagent. Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 25g, 5g, 100g, 250g, 1g , 0,25kg, 0,5kg, 1g.
Benzotriazol-1-yloxy-tris(dimethylamino)phosphanium hexafluorophosphate (CAS 56602-33-6) is a chemical compound with the molecular formula C12H22F6N6OP2 and a molecular weight of 442.28 g/mol. IUPAC name: benzotriazol-1-yloxy-tris(dimethylamino)phosphanium hexafluorophosphate. InChIKey: MGEVGECQZUIPSV-UHFFFAOYSA-N.
| Molecular formula | C12H22F6N6OP2 |
|---|---|
| Molecular weight | 442.28 g/mol |
| IUPAC name | benzotriazol-1-yloxy-tris(dimethylamino)phosphanium hexafluorophosphate |
| InChIKey | MGEVGECQZUIPSV-UHFFFAOYSA-N |
| SMILES | CN(C)[P+](N(C)C)(N(C)C)ON1C2=CC=CC=C2N=N1.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)