CAS 56612-88-5 appears in our catalog under these names: Boc–Cit–ONp, Boc-cit-onp, 95%, Boc-Cit-ONp, 97%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
(4-nitrophenyl) (2S)-5-(carbamoylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (CAS 56612-88-5) is a chemical compound with the molecular formula C17H24N4O7 and a molecular weight of 396.4 g/mol. IUPAC name: (4-nitrophenyl) (2S)-5-(carbamoylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate. InChIKey: PMMYKHSVTAQXLJ-ZDUSSCGKSA-N.
| Molecular formula | C17H24N4O7 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | (4-nitrophenyl) (2S)-5-(carbamoylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| InChIKey | PMMYKHSVTAQXLJ-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCNC(=O)N)C(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)