CAS 56661-32-6 is the registry number for 4-Bromo-n-[3-(trifluoromethyl)phenyl]benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
4-bromo-N-[3-(trifluoromethyl)phenyl]benzamide (CAS 56661-32-6) is a chemical compound with the molecular formula C14H9BrF3NO and a molecular weight of 344.13 g/mol. IUPAC name: 4-bromo-N-[3-(trifluoromethyl)phenyl]benzamide. InChIKey: URMINAWTHPPDQD-UHFFFAOYSA-N.
| Molecular formula | C14H9BrF3NO |
|---|---|
| Molecular weight | 344.13 g/mol |
| IUPAC name | 4-bromo-N-[3-(trifluoromethyl)phenyl]benzamide |
| InChIKey | URMINAWTHPPDQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)C2=CC=C(C=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)