CAS 56667-12-0 is the registry number for Benzene, 1,1'-(1E)-1,2-ethenediylbis[2-bromo-, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-bromo-2-[(E)-2-(2-bromophenyl)ethenyl]benzene (CAS 56667-12-0) is a chemical compound with the molecular formula C14H10Br2 and a molecular weight of 338.04 g/mol. IUPAC name: 1-bromo-2-[(E)-2-(2-bromophenyl)ethenyl]benzene. InChIKey: CAQJRIYIZUQIHV-MDZDMXLPSA-N.
| Molecular formula | C14H10Br2 |
|---|---|
| Molecular weight | 338.04 g/mol |
| IUPAC name | 1-bromo-2-[(E)-2-(2-bromophenyl)ethenyl]benzene |
| InChIKey | CAQJRIYIZUQIHV-MDZDMXLPSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C2=CC=CC=C2Br)Br |
Computed by PubChem (NCBI)