CAS 5667-47-0 appears in our catalog under these names: Dimethyl(2-oxo-2-phenylethyl)sulfonium bromide 97%, Dimethyl(2-oxo-2-phenylethyl)sulfonium bromide, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
Dimethyl(phenacyl)sulfanium bromide (CAS 5667-47-0) is a chemical compound with the molecular formula C10H13BrOS and a molecular weight of 261.18 g/mol. IUPAC name: dimethyl(phenacyl)sulfanium bromide. InChIKey: MOXCZQUDEPYNKM-UHFFFAOYSA-M.
| Molecular formula | C10H13BrOS |
|---|---|
| Molecular weight | 261.18 g/mol |
| IUPAC name | dimethyl(phenacyl)sulfanium bromide |
| InChIKey | MOXCZQUDEPYNKM-UHFFFAOYSA-M |
| SMILES | C[S+](C)CC(=O)C1=CC=CC=C1.[Br-] |
Computed by PubChem (NCBI)