CAS 567-95-3 is the registry number for Aloetic Acid. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-dihydroxy-2-(hydroxymethyl)-1,3,6,8-tetranitroanthracene-9,10-dione (CAS 567-95-3) is a chemical compound with the molecular formula C15H6N4O13 and a molecular weight of 450.23 g/mol. IUPAC name: 4,5-dihydroxy-2-(hydroxymethyl)-1,3,6,8-tetranitroanthracene-9,10-dione. InChIKey: QFCNNIIPXGJBQT-UHFFFAOYSA-N.
| Molecular formula | C15H6N4O13 |
|---|---|
| Molecular weight | 450.23 g/mol |
| IUPAC name | 4,5-dihydroxy-2-(hydroxymethyl)-1,3,6,8-tetranitroanthracene-9,10-dione |
| InChIKey | QFCNNIIPXGJBQT-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C(=C1[N+](=O)[O-])O)C(=O)C3=C(C2=O)C(=C(C(=C3O)[N+](=O)[O-])CO)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)