Products 56716-91-7
CAS 56716-91-7 appears in our catalog under these names: 6-Fluoro-2,3-dimethylquinolin-4-ol, 95%, 6-Fluoro-2,3-dimethylquinolin-4-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
6-fluoro-2,3-dimethyl-1H-quinolin-4-one (CAS 56716-91-7) is a chemical compound with the molecular formula C11H10FNO and a molecular weight of 191.20 g/mol. IUPAC name: 6-fluoro-2,3-dimethyl-1H-quinolin-4-one. InChIKey: CUARCPQOSINOMX-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO |
|---|---|
| Molecular weight | 191.20 g/mol |
| IUPAC name | 6-fluoro-2,3-dimethyl-1H-quinolin-4-one |
| InChIKey | CUARCPQOSINOMX-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C(C1=O)C=C(C=C2)F)C |
Computed by PubChem (NCBI)