CAS 5675-13-8 is the registry number for trans-Dihydrophthalic Acid. Offered by: TRC. Available pack sizes: 1g.
(1R,2R)-cyclohexa-3,5-diene-1,2-dicarboxylic acid (CAS 5675-13-8) is a chemical compound with the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. IUPAC name: (1R,2R)-cyclohexa-3,5-diene-1,2-dicarboxylic acid. InChIKey: OYUWHGGWLCJJNP-PHDIDXHHSA-N.
| Molecular formula | C8H8O4 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | (1R,2R)-cyclohexa-3,5-diene-1,2-dicarboxylic acid |
| InChIKey | OYUWHGGWLCJJNP-PHDIDXHHSA-N |
| SMILES | C1=C[C@H]([C@@H](C=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)