CAS 56752-35-3 appears in our catalog under these names: 3,9–Dibromoperylene, 3,9-Dibromoperylene 97% (mixture of isomers), 3,9-Dibromoperylene, 97%, 97%, 3,9-Dibromoperylene, mixture of isomers, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 25g.
3,9-dibromoperylene (CAS 56752-35-3) is a chemical compound with the molecular formula C20H10Br2 and a molecular weight of 410.1 g/mol. IUPAC name: 3,9-dibromoperylene. InChIKey: IPLAQSRFBRURHW-UHFFFAOYSA-N.
| Molecular formula | C20H10Br2 |
|---|---|
| Molecular weight | 410.1 g/mol |
| IUPAC name | 3,9-dibromoperylene |
| InChIKey | IPLAQSRFBRURHW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C(=CC=C3C4=C5C2=CC=C(C5=CC=C4)Br)Br |
Computed by PubChem (NCBI)