CAS 56759-24-1 is the registry number for (E)-1-Fluoro-4-(2-tosylvinyl)benzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g.
1-[(E)-2-(4-fluorophenyl)ethenyl]sulfonyl-4-methylbenzene (CAS 56759-24-1) is a chemical compound with the molecular formula C15H13FO2S and a molecular weight of 276.3 g/mol. IUPAC name: 1-[(E)-2-(4-fluorophenyl)ethenyl]sulfonyl-4-methylbenzene. InChIKey: DELYVKVMQBJUTF-ZHACJKMWSA-N.
| Molecular formula | C15H13FO2S |
|---|---|
| Molecular weight | 276.3 g/mol |
| IUPAC name | 1-[(E)-2-(4-fluorophenyl)ethenyl]sulfonyl-4-methylbenzene |
| InChIKey | DELYVKVMQBJUTF-ZHACJKMWSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)/C=C/C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)