CAS 56767-76-1 appears in our catalog under these names: Flurbiprofen Sodium, Flurbiprofen (sodium), Flurbiprofen (sodium) (Standard). Offered by: Chemat Brand, TRC, TargetMol, MedChemExpress. Available pack sizes: on request, 500mg, 25mg, 50mg, 100mg, Get quote.
Sodium 2-(3-fluoro-4-phenylphenyl)propanoate (CAS 56767-76-1) is a chemical compound with the molecular formula C15H12FNaO2 and a molecular weight of 266.24 g/mol. IUPAC name: sodium 2-(3-fluoro-4-phenylphenyl)propanoate. InChIKey: AUAGTGKMTMVIKN-UHFFFAOYSA-M.
| Molecular formula | C15H12FNaO2 |
|---|---|
| Molecular weight | 266.24 g/mol |
| IUPAC name | sodium 2-(3-fluoro-4-phenylphenyl)propanoate |
| InChIKey | AUAGTGKMTMVIKN-UHFFFAOYSA-M |
| SMILES | CC(C1=CC(=C(C=C1)C2=CC=CC=C2)F)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)