CAS 56773-34-3 appears in our catalog under these names: 3-(Trifluoromethylthio)phenacyl bromide, 95%, 3-(Trifluoromethylthio)phenacyl bromide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-bromo-1-[3-(trifluoromethylsulfanyl)phenyl]ethanone (CAS 56773-34-3) is a chemical compound with the molecular formula C9H6BrF3OS and a molecular weight of 299.11 g/mol. IUPAC name: 2-bromo-1-[3-(trifluoromethylsulfanyl)phenyl]ethanone. InChIKey: VZIRNYVFMKFXLJ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3OS |
|---|---|
| Molecular weight | 299.11 g/mol |
| IUPAC name | 2-bromo-1-[3-(trifluoromethylsulfanyl)phenyl]ethanone |
| InChIKey | VZIRNYVFMKFXLJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)SC(F)(F)F)C(=O)CBr |
Computed by PubChem (NCBI)