CAS 5679-89-0 is the registry number for 2,2'-Dinitro-4,4'-azoxytoluene. Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 5mg.
(4-methyl-3-nitrophenyl)-(4-methyl-3-nitrophenyl)imino-oxidoazanium (CAS 5679-89-0) is a chemical compound with the molecular formula C14H12N4O5 and a molecular weight of 316.27 g/mol. IUPAC name: (4-methyl-3-nitrophenyl)-(4-methyl-3-nitrophenyl)imino-oxidoazanium. InChIKey: CNXNJGNHOMJIMY-UHFFFAOYSA-N.
| Molecular formula | C14H12N4O5 |
|---|---|
| Molecular weight | 316.27 g/mol |
| IUPAC name | (4-methyl-3-nitrophenyl)-(4-methyl-3-nitrophenyl)imino-oxidoazanium |
| InChIKey | CNXNJGNHOMJIMY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N=[N+](C2=CC(=C(C=C2)C)[N+](=O)[O-])[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)