CAS 568-93-4 appears in our catalog under these names: 1,2-Dihydroxy-3-nitroanthraquinone, >95% (HPLC), 1,2-Dihydroxy-3-nitroanthraquinone 98%, 1,2-Dihydroxy-3-nitroanthraquinone, 98%. Offered by: TRC, Ambeed, Fluorochem. Available pack sizes: 100mg, 500mg, 50mg, 250mg, 1g.
1,2-dihydroxy-3-nitroanthracene-9,10-dione (CAS 568-93-4) is a chemical compound with the molecular formula C14H7NO6 and a molecular weight of 285.21 g/mol. IUPAC name: 1,2-dihydroxy-3-nitroanthracene-9,10-dione. InChIKey: XZSUEVFAMOKROK-UHFFFAOYSA-N.
| Molecular formula | C14H7NO6 |
|---|---|
| Molecular weight | 285.21 g/mol |
| IUPAC name | 1,2-dihydroxy-3-nitroanthracene-9,10-dione |
| InChIKey | XZSUEVFAMOKROK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=CC(=C(C(=C3C2=O)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)