CAS 56842-77-4 appears in our catalog under these names: Cefazolin EP Impurity C, Cefazolin Impurity 3(Cefazolin EP Impurity C)(Cefazolin USP RC H), 7-(1-(1H)-Tetrazolylacetamido)desacetoxycephalosporanic Acid, >95% (HPLC), 7–(1–(1H)–Tetrazolylacetamido)desacetoxycephalosporanic Acid, Cefazolin impurity C. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
(6R,7R)-3-methyl-8-oxo-7-[[2-(tetrazol-1-yl)acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 56842-77-4) is a chemical compound with the molecular formula C11H12N6O4S and a molecular weight of 324.32 g/mol. IUPAC name: (6R,7R)-3-methyl-8-oxo-7-[[2-(tetrazol-1-yl)acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: DGYURGWZOSQCFG-GMSGAONNSA-N.
| Molecular formula | C11H12N6O4S |
|---|---|
| Molecular weight | 324.32 g/mol |
| IUPAC name | (6R,7R)-3-methyl-8-oxo-7-[[2-(tetrazol-1-yl)acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | DGYURGWZOSQCFG-GMSGAONNSA-N |
| SMILES | CC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)CN3C=NN=N3)SC1)C(=O)O |
Computed by PubChem (NCBI)