CAS 568543-65-7 is the registry number for 2-Chloro-N-{5-(ethyl(phenyl)sulfamoyl)-2-methoxyphenyl}acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-N-[5-[ethyl(phenyl)sulfamoyl]-2-methoxyphenyl]acetamide (CAS 568543-65-7) is a chemical compound with the molecular formula C17H19ClN2O4S and a molecular weight of 382.9 g/mol. IUPAC name: 2-chloro-N-[5-[ethyl(phenyl)sulfamoyl]-2-methoxyphenyl]acetamide. InChIKey: HATLBPWOVVIHEI-UHFFFAOYSA-N.
| Molecular formula | C17H19ClN2O4S |
|---|---|
| Molecular weight | 382.9 g/mol |
| IUPAC name | 2-chloro-N-[5-[ethyl(phenyl)sulfamoyl]-2-methoxyphenyl]acetamide |
| InChIKey | HATLBPWOVVIHEI-UHFFFAOYSA-N |
| SMILES | CCN(C1=CC=CC=C1)S(=O)(=O)C2=CC(=C(C=C2)OC)NC(=O)CCl |
Computed by PubChem (NCBI)