CAS 568550-95-8 appears in our catalog under these names: 1-[2-(4-Chloro-phenylsulfanyl)-phenyl]-pyrrole-2,5-dione, 95%, 1-{2-((4-chlorophenyl)sulfanyl)phenyl}-2,5-dihydro-1H-pyrrole-2,5-dione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 10g, 5g.
1-[2-(4-chlorophenyl)sulfanylphenyl]pyrrole-2,5-dione (CAS 568550-95-8) is a chemical compound with the molecular formula C16H10ClNO2S and a molecular weight of 315.8 g/mol. IUPAC name: 1-[2-(4-chlorophenyl)sulfanylphenyl]pyrrole-2,5-dione. InChIKey: ZPVQRBCEYPFUQE-UHFFFAOYSA-N.
| Molecular formula | C16H10ClNO2S |
|---|---|
| Molecular weight | 315.8 g/mol |
| IUPAC name | 1-[2-(4-chlorophenyl)sulfanylphenyl]pyrrole-2,5-dione |
| InChIKey | ZPVQRBCEYPFUQE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C(=O)C=CC2=O)SC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)