CAS 568570-15-0 is the registry number for 2-({4-((2,4-dimethylphenyl)sulfamoyl)-2-nitrophenyl}amino)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[4-[(2,4-dimethylphenyl)sulfamoyl]-2-nitroanilino]acetic acid (CAS 568570-15-0) is a chemical compound with the molecular formula C16H17N3O6S and a molecular weight of 379.4 g/mol. IUPAC name: 2-[4-[(2,4-dimethylphenyl)sulfamoyl]-2-nitroanilino]acetic acid. InChIKey: DTPDHMMUDKUWGG-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O6S |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | 2-[4-[(2,4-dimethylphenyl)sulfamoyl]-2-nitroanilino]acetic acid |
| InChIKey | DTPDHMMUDKUWGG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NS(=O)(=O)C2=CC(=C(C=C2)NCC(=O)O)[N+](=O)[O-])C |
Computed by PubChem (NCBI)