CAS 56860-12-9 appears in our catalog under these names: Permethrin EP impurity H, Permethrin EP Impurity H (DCVC Anhydride) (Mixture of Diastereomers), Permethrin Impurity 8(Permethrin EP Impurity H). Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl] 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate (CAS 56860-12-9) is a chemical compound with the molecular formula C16H18Cl4O3 and a molecular weight of 400.1 g/mol. IUPAC name: [3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl] 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate. InChIKey: CFCQREDNKXNRIG-UHFFFAOYSA-N.
| Molecular formula | C16H18Cl4O3 |
|---|---|
| Molecular weight | 400.1 g/mol |
| IUPAC name | [3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl] 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| InChIKey | CFCQREDNKXNRIG-UHFFFAOYSA-N |
| SMILES | CC1(C(C1C(=O)OC(=O)C2C(C2(C)C)C=C(Cl)Cl)C=C(Cl)Cl)C |
Computed by PubChem (NCBI)