CAS 56860-83-4 is the registry number for 1,1,2,3,3,3-Hexafluoropropyl trichloromethyl ether, 98%. Offered by: Fluorochem. Available pack sizes: 1g.
1,1,1,2,3,3-hexafluoro-3-(trichloromethoxy)propane (CAS 56860-83-4) is a chemical compound with the molecular formula C4HCl3F6O and a molecular weight of 285.39 g/mol. IUPAC name: 1,1,1,2,3,3-hexafluoro-3-(trichloromethoxy)propane. InChIKey: CPUOWSYOQOXXNZ-UHFFFAOYSA-N.
| Molecular formula | C4HCl3F6O |
|---|---|
| Molecular weight | 285.39 g/mol |
| IUPAC name | 1,1,1,2,3,3-hexafluoro-3-(trichloromethoxy)propane |
| InChIKey | CPUOWSYOQOXXNZ-UHFFFAOYSA-N |
| SMILES | C(C(OC(Cl)(Cl)Cl)(F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)