Products 56879-02-8

CAS 56879-02-8 is the registry number for 5-Chloro-2,3-dihydrothiophene 1,1-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-chloro-2,3-dihydrothiophene 1,1-dioxide (CAS 56879-02-8) is a chemical compound with the molecular formula C4H5ClO2S and a molecular weight of 152.60 g/mol. IUPAC name: 5-chloro-2,3-dihydrothiophene 1,1-dioxide. InChIKey: GOFJEUGVRXSVIH-UHFFFAOYSA-N.

Identity
Molecular formulaC4H5ClO2S
Molecular weight152.60 g/mol
IUPAC name5-chloro-2,3-dihydrothiophene 1,1-dioxide
InChIKeyGOFJEUGVRXSVIH-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)C(=C1)Cl

Computed by PubChem (NCBI)