CAS 56881-53-9 is the registry number for (((2E,6E)-3,7,11-Trimethyldodeca-2,6,10-trien-1-yl)sulfonyl)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfonylbenzene (CAS 56881-53-9) is a chemical compound with the molecular formula C21H30O2S and a molecular weight of 346.5 g/mol. IUPAC name: [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfonylbenzene. InChIKey: MLMQYHDLGZNPKC-YEFHWUCQSA-N.
| Molecular formula | C21H30O2S |
|---|---|
| Molecular weight | 346.5 g/mol |
| IUPAC name | [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfonylbenzene |
| InChIKey | MLMQYHDLGZNPKC-YEFHWUCQSA-N |
| SMILES | CC(=CCC/C(=C/CC/C(=C/CS(=O)(=O)C1=CC=CC=C1)/C)/C)C |
Computed by PubChem (NCBI)