CAS 56897-54-2 appears in our catalog under these names: dipotassium eosin YS(2-), 95%, Potassium 4,5,6,7-tetrabromo-3'-hydroxy-3-oxo-3H-spiro(isobenzofuran-1,9'-xanthen)-6'-olate(2:1), Dye content 90 %, Tetrabromofluorescein Potassium Salt,85·00%, Tetrabromofluorescein Potassium Salt, >85.0%(HPLC), Tetrabromofluorescein dipotassium salt. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 25g.
Dipotassium;2-(2,4,5,7-tetrabromo-3-oxido-6-oxoxanthen-9-yl)benzoate (CAS 56897-54-2) is a chemical compound with the molecular formula C20H6Br4K2O5 and a molecular weight of 724.1 g/mol. IUPAC name: dipotassium;2-(2,4,5,7-tetrabromo-3-oxido-6-oxoxanthen-9-yl)benzoate. InChIKey: GZAAPEKTGHKWRZ-UHFFFAOYSA-L.
| Molecular formula | C20H6Br4K2O5 |
|---|---|
| Molecular weight | 724.1 g/mol |
| IUPAC name | dipotassium;2-(2,4,5,7-tetrabromo-3-oxido-6-oxoxanthen-9-yl)benzoate |
| InChIKey | GZAAPEKTGHKWRZ-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C(=C1)C2=C3C=C(C(=O)C(=C3OC4=C(C(=C(C=C24)Br)[O-])Br)Br)Br)C(=O)[O-].[K+].[K+] |
Computed by PubChem (NCBI)