CAS 569-06-2 is the registry number for 1-Fluoroanthraquinone. Offered by: TRC. Available pack sizes: 250mg.
1-fluoroanthracene-9,10-dione (CAS 569-06-2) is a chemical compound with the molecular formula C14H7FO2 and a molecular weight of 226.20 g/mol. IUPAC name: 1-fluoroanthracene-9,10-dione. InChIKey: QFDHYBLCHGMWDI-UHFFFAOYSA-N.
| Molecular formula | C14H7FO2 |
|---|---|
| Molecular weight | 226.20 g/mol |
| IUPAC name | 1-fluoroanthracene-9,10-dione |
| InChIKey | QFDHYBLCHGMWDI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=CC=C3)F |
Computed by PubChem (NCBI)