CAS 569-33-5 is the registry number for Terrinolide. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4,5-dihydroxy-9-methyl-3-oxo-1H-benzo[f][2]benzofuran-1-yl)-2,3,6-trihydroxybenzamide (CAS 569-33-5) is a chemical compound with the molecular formula C20H15NO8 and a molecular weight of 397.3 g/mol. IUPAC name: 4-(4,5-dihydroxy-9-methyl-3-oxo-1H-benzo[f][2]benzofuran-1-yl)-2,3,6-trihydroxybenzamide. InChIKey: RWFFTVBPIJUYCW-UHFFFAOYSA-N.
| Molecular formula | C20H15NO8 |
|---|---|
| Molecular weight | 397.3 g/mol |
| IUPAC name | 4-(4,5-dihydroxy-9-methyl-3-oxo-1H-benzo[f][2]benzofuran-1-yl)-2,3,6-trihydroxybenzamide |
| InChIKey | RWFFTVBPIJUYCW-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC=C(C2=C(C3=C1C(OC3=O)C4=CC(=C(C(=C4O)O)C(=O)N)O)O)O |
Computed by PubChem (NCBI)