CAS 5690-16-4 is the registry number for 1,4-Dioxo-1,4-dihydronaphthalene-2-sulfonic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,4-dioxonaphthalene-2-sulfonic acid (CAS 5690-16-4) is a chemical compound with the molecular formula C10H6O5S and a molecular weight of 238.22 g/mol. IUPAC name: 1,4-dioxonaphthalene-2-sulfonic acid. InChIKey: IAGVANYWTGRDOU-UHFFFAOYSA-N.
| Molecular formula | C10H6O5S |
|---|---|
| Molecular weight | 238.22 g/mol |
| IUPAC name | 1,4-dioxonaphthalene-2-sulfonic acid |
| InChIKey | IAGVANYWTGRDOU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C=C(C2=O)S(=O)(=O)O |
Computed by PubChem (NCBI)