Products 5690-16-4

CAS 5690-16-4 is the registry number for 1,4-Dioxo-1,4-dihydronaphthalene-2-sulfonic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1,4-dioxonaphthalene-2-sulfonic acid (CAS 5690-16-4) is a chemical compound with the molecular formula C10H6O5S and a molecular weight of 238.22 g/mol. IUPAC name: 1,4-dioxonaphthalene-2-sulfonic acid. InChIKey: IAGVANYWTGRDOU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6O5S
Molecular weight238.22 g/mol
IUPAC name1,4-dioxonaphthalene-2-sulfonic acid
InChIKeyIAGVANYWTGRDOU-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)C=C(C2=O)S(=O)(=O)O

Computed by PubChem (NCBI)