CAS 5691-15-6 is the registry number for ((1R,2R)-2-amino-cyclohexyl)-methanol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R,2S)-2-aminocyclohexyl]methanol (CAS 5691-15-6) is a chemical compound with the molecular formula C7H15NO and a molecular weight of 129.20 g/mol. IUPAC name: [(1R,2S)-2-aminocyclohexyl]methanol. InChIKey: GCWPGEWXYDEQAY-BQBZGAKWSA-N.
| Molecular formula | C7H15NO |
|---|---|
| Molecular weight | 129.20 g/mol |
| IUPAC name | [(1R,2S)-2-aminocyclohexyl]methanol |
| InChIKey | GCWPGEWXYDEQAY-BQBZGAKWSA-N |
| SMILES | C1CC[C@@H]([C@@H](C1)CO)N |
Computed by PubChem (NCBI)