CAS 5691-19-0 appears in our catalog under these names: 2-Aminocyclohexane-1-carboxylic acid hydrochloride, 95%, Trans-2-amino-1-cyclohexanecarboxylicacid, 98%, trans-2-Amino-1-cyclohexanecarboxylic acid, 98%. Offered by: Combi-blocks, AmBeed, Thermo Scientific (Acros). Available pack sizes: 5g, 250mg, 1g, 100mg.
Trans-(1R,2R)-2-aminocyclohexane-1-carboxylic acid (CAS 5691-19-0) is a chemical compound with the molecular formula C7H13NO2 and a molecular weight of 143.18 g/mol. IUPAC name: trans-(1R,2R)-2-aminocyclohexane-1-carboxylic acid. InChIKey: USQHEVWOPJDAAX-PHDIDXHHSA-N.
| Molecular formula | C7H13NO2 |
|---|---|
| Molecular weight | 143.18 g/mol |
| IUPAC name | trans-(1R,2R)-2-aminocyclohexane-1-carboxylic acid |
| InChIKey | USQHEVWOPJDAAX-PHDIDXHHSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)C(=O)O)N |
Computed by PubChem (NCBI)