Products 56911-49-0
CAS 56911-49-0 appears in our catalog under these names: 2-(3-(Benzyloxy)phenyl)propanoic acid, 95-<97%, 2-(3-(Benzyloxy)phenyl)propanoic acid, ≥97-<99%, 2-(3-(Benzyloxy)phenyl)propanoic acid, 97%, 2-(3-(Benzyloxy)phenyl)propanoic acid, 95%, 95%, 2-(3-Benzyloxyphenyl)propionic acid, 95%. Offered by: Hoffman Fine Chemicals, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50mg, 100mg, 250mg.
2-(3-phenylmethoxyphenyl)propanoic acid (CAS 56911-49-0) is a chemical compound with the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. IUPAC name: 2-(3-phenylmethoxyphenyl)propanoic acid. InChIKey: QTVCXUJSHZJQHJ-UHFFFAOYSA-N.
| Molecular formula | C16H16O3 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | 2-(3-phenylmethoxyphenyl)propanoic acid |
| InChIKey | QTVCXUJSHZJQHJ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)